C11H14O5S — CID 117399283
3-(3-hydroxy-2-methylsulfonylphenyl)-2-methylpropanoic acid (PubChem CID 117399283) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is 3-(3-hydroxy-2-methylsulfonylphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(3-hydroxy-2-methylsulfonylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117399283 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-(3-hydroxy-2-methylsulfonylphenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cccc(O)c1S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H14O5S/c1-7(11(13)14)6-8-4-3-5-9(12)10(8)17(2,15)16/h3-5,7,12H,6H2,1-2H3,(H,13,14) |
| InChIKey | MYOTYVKMMODPMU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |