C10H10Cl2O2 — CID 95001565
(2S)-3-(3,5-dichlorophenyl)-2-methylpropanoic acid (PubChem CID 95001565) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is (2S)-3-(3,5-dichlorophenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-3-(3,5-dichlorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 95001565 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (2S)-3-(3,5-dichlorophenyl)-2-methylpropanoic acid |
| SMILES | C[C@@H](Cc1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H10Cl2O2/c1-6(10(13)14)2-7-3-8(11)5-9(12)4-7/h3-6H,2H2,1H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | REOQUNARKTYCEN-LURJTMIESA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |