About (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine
(2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine (PubChem CID 167711983) has the molecular formula C10H11ClF2O2
and a molecular weight of 236.64 g/mol. Its IUPAC name is (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine.
Molecular Properties
| Compound Name | (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine |
| PubChem CID | 167711983 |
| Molecular Formula | C10H11ClF2O2 |
| Molecular Weight | 236.64 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine |
| SMILES | C[C@H](Cc1cccc(Cl)c1)C(=O)O.FF |
| InChI | InChI=1S/C10H11ClO2.F2/c1-7(10(12)13)5-8-3-2-4-9(11)6-8;1-2/h2-4,6-7H,5H2,1H3,(H,12,13);/t7-;/m1./s1 |
| InChIKey | ZYZXQVFORJCQHX-OGFXRTJISA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine?
The IUPAC name of (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine (CID 167711983) is (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine.
What is the SMILES notation for (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine?
The canonical SMILES for (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine is C[C@H](Cc1cccc(Cl)c1)C(=O)O.FF.
What is the InChIKey of (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine?
The InChIKey is ZYZXQVFORJCQHX-OGFXRTJISA-N. The full InChI is InChI=1S/C10H11ClO2.F2/c1-7(10(12)13)5-8-3-2-4-9(11)6-8;1-2/h2-4,6-7H,5H2,1H3,(H,12,13);/t7-;/m1./s1.
What are the key properties of (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine?
(2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine has a molecular weight of 236.64 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(3-chlorophenyl)-2-methylpropanoic acid;molecular fluorine is sourced from PubChem (CID 167711983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).