C11H12ClFO2 — CID 80694134
2-[(3-chlorophenyl)methyl]-4-fluorobutanoic acid (PubChem CID 80694134) has the molecular formula C11H12ClFO2 and a molecular weight of 230.67 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4-fluorobutanoic acid.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4-fluorobutanoic acid |
|---|---|
| PubChem CID | 80694134 |
| Molecular Formula | C11H12ClFO2 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4-fluorobutanoic acid |
| SMILES | O=C(O)C(CCF)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClFO2/c12-10-3-1-2-8(7-10)6-9(4-5-13)11(14)15/h1-3,7,9H,4-6H2,(H,14,15) |
| InChIKey | USOGXSNTDZNXBK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |