C16H14ClFO2 — CID 60793205
2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid (PubChem CID 60793205) has the molecular formula C16H14ClFO2 and a molecular weight of 292.74 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 60793205 |
| Molecular Formula | C16H14ClFO2 |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(F)cc1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClFO2/c17-14-3-1-2-12(10-14)9-13(16(19)20)8-11-4-6-15(18)7-5-11/h1-7,10,13H,8-9H2,(H,19,20) |
| InChIKey | KMZZROPFXVPLRK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |