C16H13BrClFO2 — CID 60793370
2-[(2-bromo-4-fluorophenyl)methyl]-3-(3-chlorophenyl)propanoic acid (PubChem CID 60793370) has the molecular formula C16H13BrClFO2 and a molecular weight of 371.63 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methyl]-3-(3-chlorophenyl)propanoic acid.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methyl]-3-(3-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 60793370 |
| Molecular Formula | C16H13BrClFO2 |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methyl]-3-(3-chlorophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Cl)c1)Cc1ccc(F)cc1Br |
| InChI | InChI=1S/C16H13BrClFO2/c17-15-9-14(19)5-4-11(15)8-12(16(20)21)6-10-2-1-3-13(18)7-10/h1-5,7,9,12H,6,8H2,(H,20,21) |
| InChIKey | YAHUNTWCZHTYJO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |