C19H18ClFO4 — CID 156884247
(2S)-5-[(3-chlorophenyl)methoxy]-2-[(3-fluorophenyl)methyl]-5-oxopentanoic acid (PubChem CID 156884247) has the molecular formula C19H18ClFO4 and a molecular weight of 364.80 g/mol. Its IUPAC name is (2S)-5-[(3-chlorophenyl)methoxy]-2-[(3-fluorophenyl)methyl]-5-oxopentanoic acid.
| Compound Name | (2S)-5-[(3-chlorophenyl)methoxy]-2-[(3-fluorophenyl)methyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 156884247 |
| Molecular Formula | C19H18ClFO4 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2S)-5-[(3-chlorophenyl)methoxy]-2-[(3-fluorophenyl)methyl]-5-oxopentanoic acid |
| SMILES | O=C(CC[C@@H](Cc1cccc(F)c1)C(=O)O)OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClFO4/c20-16-5-1-4-14(10-16)12-25-18(22)8-7-15(19(23)24)9-13-3-2-6-17(21)11-13/h1-6,10-11,15H,7-9,12H2,(H,23,24)/t15-/m0/s1 |
| InChIKey | LIKGXXZCFCBTQR-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |