(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate

C17H14F2O3 — CID 78760378

IUPAC(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate
SMILESO=C(CCC(=O)c1ccc(F)cc1)OCc1cccc(F)c1
InChIInChI=1S/C17H14F2O3/c18-14-6-4-13(5-7-14)16(20)8-9-17(21)22-11-12-2-1-3-15(19)10-12/h1-7,10H,8-9,11H2
InChIKeyREEOTRQQRJWKPW-UHFFFAOYSA-N
MW304.29 g/mol
LogP3.67
Rot. Bonds6

About (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate

(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 78760378) has the molecular formula C17H14F2O3 and a molecular weight of 304.29 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate.

Molecular Properties

Compound Name(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate
PubChem CID78760378
Molecular FormulaC17H14F2O3
Molecular Weight304.29 g/mol
Exact Mass304.09
IUPAC Name(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate
SMILESO=C(CCC(=O)c1ccc(F)cc1)OCc1cccc(F)c1
InChIInChI=1S/C17H14F2O3/c18-14-6-4-13(5-7-14)16(20)8-9-17(21)22-11-12-2-1-3-15(19)10-12/h1-7,10H,8-9,11H2
InChIKeyREEOTRQQRJWKPW-UHFFFAOYSA-N
XLogP3.67
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.29
LogP ≤ 53.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate?
The IUPAC name of (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate (CID 78760378) is (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate.
What is the SMILES notation for (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate?
The canonical SMILES for (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate is O=C(CCC(=O)c1ccc(F)cc1)OCc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate?
The InChIKey is REEOTRQQRJWKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2O3/c18-14-6-4-13(5-7-14)16(20)8-9-17(21)22-11-12-2-1-3-15(19)10-12/h1-7,10H,8-9,11H2.
What are the key properties of (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate?
(3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate has a molecular weight of 304.29 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl 4-(4-fluorophenyl)-4-oxobutanoate is sourced from PubChem (CID 78760378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).