About (3-fluorophenyl)methyl 2-cyclopentylacetate
(3-fluorophenyl)methyl 2-cyclopentylacetate (PubChem CID 78760193) has the molecular formula C14H17FO2
and a molecular weight of 236.29 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2-cyclopentylacetate.
Molecular Properties
| Compound Name | (3-fluorophenyl)methyl 2-cyclopentylacetate |
| PubChem CID | 78760193 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3-fluorophenyl)methyl 2-cyclopentylacetate |
| SMILES | O=C(CC1CCCC1)OCc1cccc(F)c1 |
| InChI | InChI=1S/C14H17FO2/c15-13-7-3-6-12(8-13)10-17-14(16)9-11-4-1-2-5-11/h3,6-8,11H,1-2,4-5,9-10H2 |
| InChIKey | KDMJUTLVRIQICD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-fluorophenyl)methyl 2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl)methyl 2-cyclopentylacetate?
The IUPAC name of (3-fluorophenyl)methyl 2-cyclopentylacetate (CID 78760193) is (3-fluorophenyl)methyl 2-cyclopentylacetate.
What is the SMILES notation for (3-fluorophenyl)methyl 2-cyclopentylacetate?
The canonical SMILES for (3-fluorophenyl)methyl 2-cyclopentylacetate is O=C(CC1CCCC1)OCc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl)methyl 2-cyclopentylacetate?
The InChIKey is KDMJUTLVRIQICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FO2/c15-13-7-3-6-12(8-13)10-17-14(16)9-11-4-1-2-5-11/h3,6-8,11H,1-2,4-5,9-10H2.
What are the key properties of (3-fluorophenyl)methyl 2-cyclopentylacetate?
(3-fluorophenyl)methyl 2-cyclopentylacetate has a molecular weight of 236.29 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)methyl 2-cyclopentylacetate is sourced from PubChem (CID 78760193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).