About (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate
(3-bromophenyl)methyl 2-(azetidin-3-yl)acetate (PubChem CID 82824071) has the molecular formula C12H14BrNO2
and a molecular weight of 284.15 g/mol. Its IUPAC name is (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate |
| PubChem CID | 82824071 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate |
| SMILES | O=C(CC1CNC1)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrNO2/c13-11-3-1-2-9(4-11)8-16-12(15)5-10-6-14-7-10/h1-4,10,14H,5-8H2 |
| InChIKey | LVLYCERLAICYDV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate?
The IUPAC name of (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate (CID 82824071) is (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate.
What is the SMILES notation for (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate?
The canonical SMILES for (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate is O=C(CC1CNC1)OCc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate?
The InChIKey is LVLYCERLAICYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO2/c13-11-3-1-2-9(4-11)8-16-12(15)5-10-6-14-7-10/h1-4,10,14H,5-8H2.
What are the key properties of (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate?
(3-bromophenyl)methyl 2-(azetidin-3-yl)acetate has a molecular weight of 284.15 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl 2-(azetidin-3-yl)acetate is sourced from PubChem (CID 82824071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).