About (3-bromophenyl)methyl 3-amino-3-methylbutanoate
(3-bromophenyl)methyl 3-amino-3-methylbutanoate (PubChem CID 82824054) has the molecular formula C12H16BrNO2
and a molecular weight of 286.17 g/mol. Its IUPAC name is (3-bromophenyl)methyl 3-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl 3-amino-3-methylbutanoate |
| PubChem CID | 82824054 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | (3-bromophenyl)methyl 3-amino-3-methylbutanoate |
| SMILES | CC(C)(N)CC(=O)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrNO2/c1-12(2,14)7-11(15)16-8-9-4-3-5-10(13)6-9/h3-6H,7-8,14H2,1-2H3 |
| InChIKey | QDCRRHYFWCLFPM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl)methyl 3-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl 3-amino-3-methylbutanoate?
The IUPAC name of (3-bromophenyl)methyl 3-amino-3-methylbutanoate (CID 82824054) is (3-bromophenyl)methyl 3-amino-3-methylbutanoate.
What is the SMILES notation for (3-bromophenyl)methyl 3-amino-3-methylbutanoate?
The canonical SMILES for (3-bromophenyl)methyl 3-amino-3-methylbutanoate is CC(C)(N)CC(=O)OCc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)methyl 3-amino-3-methylbutanoate?
The InChIKey is QDCRRHYFWCLFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO2/c1-12(2,14)7-11(15)16-8-9-4-3-5-10(13)6-9/h3-6H,7-8,14H2,1-2H3.
What are the key properties of (3-bromophenyl)methyl 3-amino-3-methylbutanoate?
(3-bromophenyl)methyl 3-amino-3-methylbutanoate has a molecular weight of 286.17 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl 3-amino-3-methylbutanoate is sourced from PubChem (CID 82824054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).