C16H23BrO2 — CID 101476488
1-[(3-bromophenyl)methoxy]-2,2,4,4-tetramethylpentan-3-one (PubChem CID 101476488) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methoxy]-2,2,4,4-tetramethylpentan-3-one.
| Compound Name | 1-[(3-bromophenyl)methoxy]-2,2,4,4-tetramethylpentan-3-one |
|---|---|
| PubChem CID | 101476488 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-[(3-bromophenyl)methoxy]-2,2,4,4-tetramethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(C)(C)COCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H23BrO2/c1-15(2,3)14(18)16(4,5)11-19-10-12-7-6-8-13(17)9-12/h6-9H,10-11H2,1-5H3 |
| InChIKey | DFAIQYKAQRTCQV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |