C14H22BrNO3S — CID 82826695
2-[(3-bromophenyl)methoxymethyl]-2-ethylbutane-1-sulfonamide (PubChem CID 82826695) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methoxymethyl]-2-ethylbutane-1-sulfonamide.
| Compound Name | 2-[(3-bromophenyl)methoxymethyl]-2-ethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 82826695 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-[(3-bromophenyl)methoxymethyl]-2-ethylbutane-1-sulfonamide |
| SMILES | CCC(CC)(COCc1cccc(Br)c1)CS(N)(=O)=O |
| InChI | InChI=1S/C14H22BrNO3S/c1-3-14(4-2,11-20(16,17)18)10-19-9-12-6-5-7-13(15)8-12/h5-8H,3-4,9-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | LGZMPLLZMXUYMR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |