C12H18BrNO3S — CID 82826620
5-[(3-bromophenyl)methoxy]pentane-1-sulfonamide (PubChem CID 82826620) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 5-[(3-bromophenyl)methoxy]pentane-1-sulfonamide.
| Compound Name | 5-[(3-bromophenyl)methoxy]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 82826620 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5-[(3-bromophenyl)methoxy]pentane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCCCOCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrNO3S/c13-12-6-4-5-11(9-12)10-17-7-2-1-3-8-18(14,15)16/h4-6,9H,1-3,7-8,10H2,(H2,14,15,16) |
| InChIKey | AHJIJFWOHFEDIM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|