C15H24BrNO3S — CID 105343891
9-(3-bromophenoxy)nonane-1-sulfonamide (PubChem CID 105343891) has the molecular formula C15H24BrNO3S and a molecular weight of 378.33 g/mol. Its IUPAC name is 9-(3-bromophenoxy)nonane-1-sulfonamide.
| Compound Name | 9-(3-bromophenoxy)nonane-1-sulfonamide |
|---|---|
| PubChem CID | 105343891 |
| Molecular Formula | C15H24BrNO3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 9-(3-bromophenoxy)nonane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCCCCCCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrNO3S/c16-14-9-8-10-15(13-14)20-11-6-4-2-1-3-5-7-12-21(17,18)19/h8-10,13H,1-7,11-12H2,(H2,17,18,19) |
| InChIKey | RHPAJHPGVIAGDC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|