C12H15F4NO3S — CID 102747732
5-[4-fluoro-3-(trifluoromethyl)phenoxy]pentane-1-sulfonamide (PubChem CID 102747732) has the molecular formula C12H15F4NO3S and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-[4-fluoro-3-(trifluoromethyl)phenoxy]pentane-1-sulfonamide.
| Compound Name | 5-[4-fluoro-3-(trifluoromethyl)phenoxy]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 102747732 |
| Molecular Formula | C12H15F4NO3S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-[4-fluoro-3-(trifluoromethyl)phenoxy]pentane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCCCOc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F4NO3S/c13-11-5-4-9(8-10(11)12(14,15)16)20-6-2-1-3-7-21(17,18)19/h4-5,8H,1-3,6-7H2,(H2,17,18,19) |
| InChIKey | SCYDHVCTNXLVHE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|