C9H11BrFNO3S — CID 65202554
3-(4-bromo-3-fluorophenoxy)propane-1-sulfonamide (PubChem CID 65202554) has the molecular formula C9H11BrFNO3S and a molecular weight of 312.16 g/mol. Its IUPAC name is 3-(4-bromo-3-fluorophenoxy)propane-1-sulfonamide.
| Compound Name | 3-(4-bromo-3-fluorophenoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 65202554 |
| Molecular Formula | C9H11BrFNO3S |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 3-(4-bromo-3-fluorophenoxy)propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCOc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C9H11BrFNO3S/c10-8-3-2-7(6-9(8)11)15-4-1-5-16(12,13)14/h2-3,6H,1,4-5H2,(H2,12,13,14) |
| InChIKey | WWRJFJPDLXBDGH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|