C21H22Br2F2O3 — CID 122542604
1,9-bis(4-bromo-3-fluorophenoxy)nonan-5-one (PubChem CID 122542604) has the molecular formula C21H22Br2F2O3 and a molecular weight of 520.21 g/mol. Its IUPAC name is 1,9-bis(4-bromo-3-fluorophenoxy)nonan-5-one.
| Compound Name | 1,9-bis(4-bromo-3-fluorophenoxy)nonan-5-one |
|---|---|
| PubChem CID | 122542604 |
| Molecular Formula | C21H22Br2F2O3 |
| Molecular Weight | 520.21 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | 1,9-bis(4-bromo-3-fluorophenoxy)nonan-5-one |
| SMILES | O=C(CCCCOc1ccc(Br)c(F)c1)CCCCOc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C21H22Br2F2O3/c22-18-9-7-16(13-20(18)24)27-11-3-1-5-15(26)6-2-4-12-28-17-8-10-19(23)21(25)14-17/h7-10,13-14H,1-6,11-12H2 |
| InChIKey | PRLWNAUAYLEIIJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.21 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|