C12H14BrFO3 — CID 65248321
4-(4-bromo-3-fluorophenoxy)-2,2-dimethylbutanoic acid (PubChem CID 65248321) has the molecular formula C12H14BrFO3 and a molecular weight of 305.14 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorophenoxy)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(4-bromo-3-fluorophenoxy)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65248321 |
| Molecular Formula | C12H14BrFO3 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 4-(4-bromo-3-fluorophenoxy)-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCOc1ccc(Br)c(F)c1)C(=O)O |
| InChI | InChI=1S/C12H14BrFO3/c1-12(2,11(15)16)5-6-17-8-3-4-9(13)10(14)7-8/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | IMWTXEUDLHVBMV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |