C14H18F2O3 — CID 106714320
6-(3,4-difluorophenoxy)-2,2-dimethylhexanoic acid (PubChem CID 106714320) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 6-(3,4-difluorophenoxy)-2,2-dimethylhexanoic acid.
| Compound Name | 6-(3,4-difluorophenoxy)-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 106714320 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 6-(3,4-difluorophenoxy)-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H18F2O3/c1-14(2,13(17)18)7-3-4-8-19-10-5-6-11(15)12(16)9-10/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,18) |
| InChIKey | ZZDOJNIVFWVCOH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|