C13H19F2NO2 — CID 64814224
1-amino-6-(3,4-difluorophenoxy)-2-methylhexan-2-ol (PubChem CID 64814224) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-amino-6-(3,4-difluorophenoxy)-2-methylhexan-2-ol.
| Compound Name | 1-amino-6-(3,4-difluorophenoxy)-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 64814224 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-amino-6-(3,4-difluorophenoxy)-2-methylhexan-2-ol |
| SMILES | CC(O)(CN)CCCCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO2/c1-13(17,9-16)6-2-3-7-18-10-4-5-11(14)12(15)8-10/h4-5,8,17H,2-3,6-7,9,16H2,1H3 |
| InChIKey | BCKKCBNFDSXTLX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|