C13H19F2NO2 — CID 82353668
5-[2-(3,4-difluorophenoxy)ethoxy]pentan-1-amine (PubChem CID 82353668) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 5-[2-(3,4-difluorophenoxy)ethoxy]pentan-1-amine.
| Compound Name | 5-[2-(3,4-difluorophenoxy)ethoxy]pentan-1-amine |
|---|---|
| PubChem CID | 82353668 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-[2-(3,4-difluorophenoxy)ethoxy]pentan-1-amine |
| SMILES | NCCCCCOCCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO2/c14-12-5-4-11(10-13(12)15)18-9-8-17-7-3-1-2-6-16/h4-5,10H,1-3,6-9,16H2 |
| InChIKey | HUBRWFOACVWHES-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|