C15H25NO2 — CID 64815058
1-amino-4-(3-tert-butylphenoxy)-2-methylbutan-2-ol (PubChem CID 64815058) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-amino-4-(3-tert-butylphenoxy)-2-methylbutan-2-ol.
| Compound Name | 1-amino-4-(3-tert-butylphenoxy)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 64815058 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-amino-4-(3-tert-butylphenoxy)-2-methylbutan-2-ol |
| SMILES | CC(O)(CN)CCOc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO2/c1-14(2,3)12-6-5-7-13(10-12)18-9-8-15(4,17)11-16/h5-7,10,17H,8-9,11,16H2,1-4H3 |
| InChIKey | WSNDVFMEXQDSIU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |