About 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide
3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide (PubChem CID 43169674) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide |
| PubChem CID | 43169674 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide |
| SMILES | CC(C)(C)c1cccc(OCC/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,3)10-5-4-6-11(9-10)17-8-7-12(14)15-16/h4-6,9,16H,7-8H2,1-3H3,(H2,14,15) |
| InChIKey | AQHJGXNZJJJETJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide?
The IUPAC name of 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide (CID 43169674) is 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide?
The canonical SMILES for 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide is CC(C)(C)c1cccc(OCC/C(N)=N/O)c1.
What is the InChIKey of 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide?
The InChIKey is AQHJGXNZJJJETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-13(2,3)10-5-4-6-11(9-10)17-8-7-12(14)15-16/h4-6,9,16H,7-8H2,1-3H3,(H2,14,15).
What are the key properties of 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide?
3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide has a molecular weight of 236.31 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butylphenoxy)-N'-hydroxypropanimidamide is sourced from PubChem (CID 43169674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).