About 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide
5-(3-ethylphenoxy)-N'-hydroxypentanimidamide (PubChem CID 54965601) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide |
| PubChem CID | 54965601 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide |
| SMILES | CCc1cccc(OCCCCC(N)=NO)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-2-11-6-5-7-12(10-11)17-9-4-3-8-13(14)15-16/h5-7,10,16H,2-4,8-9H2,1H3,(H2,14,15) |
| InChIKey | NEUVKLVYFLMJOZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide?
The IUPAC name of 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide (CID 54965601) is 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide.
What is the SMILES notation for 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide?
The canonical SMILES for 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide is CCc1cccc(OCCCCC(N)=NO)c1.
What is the InChIKey of 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide?
The InChIKey is NEUVKLVYFLMJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-2-11-6-5-7-12(10-11)17-9-4-3-8-13(14)15-16/h5-7,10,16H,2-4,8-9H2,1H3,(H2,14,15).
What are the key properties of 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide?
5-(3-ethylphenoxy)-N'-hydroxypentanimidamide has a molecular weight of 236.31 g/mol, XLogP of 2.54, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-ethylphenoxy)-N'-hydroxypentanimidamide is sourced from PubChem (CID 54965601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).