C14H17F3O3 — CID 65254753
2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoic acid (PubChem CID 65254753) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoic acid.
| Compound Name | 2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 65254753 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2,2-dimethyl-5-[4-(trifluoromethyl)phenoxy]pentanoic acid |
| SMILES | CC(C)(CCCOc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H17F3O3/c1-13(2,12(18)19)8-3-9-20-11-6-4-10(5-7-11)14(15,16)17/h4-7H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | HLBFTNSLVVRJON-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|