C14H19BrO3 — CID 83134209
5-(4-bromo-3-methylphenoxy)-2,2-dimethylpentanoic acid (PubChem CID 83134209) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 5-(4-bromo-3-methylphenoxy)-2,2-dimethylpentanoic acid.
| Compound Name | 5-(4-bromo-3-methylphenoxy)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 83134209 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(4-bromo-3-methylphenoxy)-2,2-dimethylpentanoic acid |
| SMILES | Cc1cc(OCCCC(C)(C)C(=O)O)ccc1Br |
| InChI | InChI=1S/C14H19BrO3/c1-10-9-11(5-6-12(10)15)18-8-4-7-14(2,3)13(16)17/h5-6,9H,4,7-8H2,1-3H3,(H,16,17) |
| InChIKey | IVRFREGSQILTHQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|