C13H17BrO3 — CID 65260015
5-(2-bromophenoxy)-2,2-dimethylpentanoic acid (PubChem CID 65260015) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 5-(2-bromophenoxy)-2,2-dimethylpentanoic acid.
| Compound Name | 5-(2-bromophenoxy)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 65260015 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-(2-bromophenoxy)-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCOc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C13H17BrO3/c1-13(2,12(15)16)8-5-9-17-11-7-4-3-6-10(11)14/h3-4,6-7H,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | VDFCPICDBSFVSU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|