C15H21BrO5 — CID 146405826
5-(4-bromo-2,5-dimethoxyphenoxy)-2,2-dimethylpentanoic acid (PubChem CID 146405826) has the molecular formula C15H21BrO5 and a molecular weight of 361.23 g/mol. Its IUPAC name is 5-(4-bromo-2,5-dimethoxyphenoxy)-2,2-dimethylpentanoic acid.
| Compound Name | 5-(4-bromo-2,5-dimethoxyphenoxy)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 146405826 |
| Molecular Formula | C15H21BrO5 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-(4-bromo-2,5-dimethoxyphenoxy)-2,2-dimethylpentanoic acid |
| SMILES | COc1cc(OCCCC(C)(C)C(=O)O)c(OC)cc1Br |
| InChI | InChI=1S/C15H21BrO5/c1-15(2,14(17)18)6-5-7-21-13-9-11(19-3)10(16)8-12(13)20-4/h8-9H,5-7H2,1-4H3,(H,17,18) |
| InChIKey | AQTODMIADKLLQD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|