C13H17NO6 — CID 65248150
4-(2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanoic acid (PubChem CID 65248150) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-(2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65248150 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-(2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1OCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H17NO6/c1-13(2,12(15)16)6-7-20-11-8-9(14(17)18)4-5-10(11)19-3/h4-5,8H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | LKEUENMCRUGBNH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|