C13H20N2O8 — CID 175523332
1,2-bis(2-methoxyethoxy)-4-nitrobenzene;carbamic acid (PubChem CID 175523332) has the molecular formula C13H20N2O8 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1,2-bis(2-methoxyethoxy)-4-nitrobenzene;carbamic acid.
| Compound Name | 1,2-bis(2-methoxyethoxy)-4-nitrobenzene;carbamic acid |
|---|---|
| PubChem CID | 175523332 |
| Molecular Formula | C13H20N2O8 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1,2-bis(2-methoxyethoxy)-4-nitrobenzene;carbamic acid |
| SMILES | COCCOc1ccc([N+](=O)[O-])cc1OCCOC.NC(=O)O |
| InChI | InChI=1S/C12H17NO6.CH3NO2/c1-16-5-7-18-11-4-3-10(13(14)15)9-12(11)19-8-6-17-2;2-1(3)4/h3-4,9H,5-8H2,1-2H3;2H2,(H,3,4) |
| InChIKey | OOJWBQWTCOQOSK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|