C15H23Br2NO2 — CID 79403943
N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-3,3-dimethylbutan-1-amine (PubChem CID 79403943) has the molecular formula C15H23Br2NO2 and a molecular weight of 409.16 g/mol. Its IUPAC name is N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-3,3-dimethylbutan-1-amine.
| Compound Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 79403943 |
| Molecular Formula | C15H23Br2NO2 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-3,3-dimethylbutan-1-amine |
| SMILES | COc1cc(Br)c(OCCNCCC(C)(C)C)cc1Br |
| InChI | InChI=1S/C15H23Br2NO2/c1-15(2,3)5-6-18-7-8-20-14-10-11(16)13(19-4)9-12(14)17/h9-10,18H,5-8H2,1-4H3 |
| InChIKey | UNLJRHINLQXNIE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|