C12H15Br2NO2 — CID 79403871
N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]prop-2-en-1-amine (PubChem CID 79403871) has the molecular formula C12H15Br2NO2 and a molecular weight of 365.07 g/mol. Its IUPAC name is N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79403871 |
| Molecular Formula | C12H15Br2NO2 |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNCCOc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C12H15Br2NO2/c1-3-4-15-5-6-17-12-8-9(13)11(16-2)7-10(12)14/h3,7-8,15H,1,4-6H2,2H3 |
| InChIKey | YPCUALDJCXNLGB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|