C16H17Br2NO2 — CID 79407221
N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-2-methylaniline (PubChem CID 79407221) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-2-methylaniline.
| Compound Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 79407221 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-[2-(2,5-dibromo-4-methoxyphenoxy)ethyl]-2-methylaniline |
| SMILES | COc1cc(Br)c(OCCNc2ccccc2C)cc1Br |
| InChI | InChI=1S/C16H17Br2NO2/c1-11-5-3-4-6-14(11)19-7-8-21-16-10-12(17)15(20-2)9-13(16)18/h3-6,9-10,19H,7-8H2,1-2H3 |
| InChIKey | BCZJOFZACQOUHB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|