C8H7Br2ClO2 — CID 79529092
1,4-dibromo-2-(chloromethoxy)-5-methoxybenzene (PubChem CID 79529092) has the molecular formula C8H7Br2ClO2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1,4-dibromo-2-(chloromethoxy)-5-methoxybenzene.
| Compound Name | 1,4-dibromo-2-(chloromethoxy)-5-methoxybenzene |
|---|---|
| PubChem CID | 79529092 |
| Molecular Formula | C8H7Br2ClO2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 327.85 |
| IUPAC Name | 1,4-dibromo-2-(chloromethoxy)-5-methoxybenzene |
| SMILES | COc1cc(Br)c(OCCl)cc1Br |
| InChI | InChI=1S/C8H7Br2ClO2/c1-12-7-2-6(10)8(13-4-11)3-5(7)9/h2-3H,4H2,1H3 |
| InChIKey | COCZUPYZYFOAAJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|