C11H15Br2NO4S — CID 79403949
4-(2,5-dibromo-4-methoxyphenoxy)butane-1-sulfonamide (PubChem CID 79403949) has the molecular formula C11H15Br2NO4S and a molecular weight of 417.12 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methoxyphenoxy)butane-1-sulfonamide.
| Compound Name | 4-(2,5-dibromo-4-methoxyphenoxy)butane-1-sulfonamide |
|---|---|
| PubChem CID | 79403949 |
| Molecular Formula | C11H15Br2NO4S |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 4-(2,5-dibromo-4-methoxyphenoxy)butane-1-sulfonamide |
| SMILES | COc1cc(Br)c(OCCCCS(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C11H15Br2NO4S/c1-17-10-6-9(13)11(7-8(10)12)18-4-2-3-5-19(14,15)16/h6-7H,2-5H2,1H3,(H2,14,15,16) |
| InChIKey | ZKEUVSPJYYWQSA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|