About disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate
disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate (PubChem CID 102054536) has the molecular formula C14H18Br2Na2O8S2
and a molecular weight of 584.21 g/mol. Its IUPAC name is disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate.
Molecular Properties
| Compound Name | disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate |
| PubChem CID | 102054536 |
| Molecular Formula | C14H18Br2Na2O8S2 |
| Molecular Weight | 584.21 g/mol |
| Exact Mass | 581.86 |
| IUPAC Name | disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCOc1cc(Br)c(OCCCCS(=O)(=O)[O-])cc1Br.[Na+].[Na+] |
| InChI | InChI=1S/C14H20Br2O8S2.2Na/c15-11-10-14(24-6-2-4-8-26(20,21)22)12(16)9-13(11)23-5-1-3-7-25(17,18)19;;/h9-10H,1-8H2,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | VEKQOPLAKYXMHK-UHFFFAOYSA-L |
| XLogP | -3.37 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 584.21 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate?
The IUPAC name of disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate (CID 102054536) is disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate.
What is the SMILES notation for disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate?
The canonical SMILES for disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate is O=S(=O)([O-])CCCCOc1cc(Br)c(OCCCCS(=O)(=O)[O-])cc1Br.[Na+].[Na+].
What is the InChIKey of disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate?
The InChIKey is VEKQOPLAKYXMHK-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H20Br2O8S2.2Na/c15-11-10-14(24-6-2-4-8-26(20,21)22)12(16)9-13(11)23-5-1-3-7-25(17,18)19;;/h9-10H,1-8H2,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2.
What are the key properties of disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate?
disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate has a molecular weight of 584.21 g/mol, XLogP of -3.37, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate is sourced from PubChem (CID 102054536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).