C14H18Br2Na2O8S2 — CID 102054536
disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate (PubChem CID 102054536) has the molecular formula C14H18Br2Na2O8S2 and a molecular weight of 584.21 g/mol. Its IUPAC name is disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate.
| Compound Name | disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 102054536 |
| Molecular Formula | C14H18Br2Na2O8S2 |
| Molecular Weight | 584.21 g/mol |
| Exact Mass | 581.86 |
| IUPAC Name | disodium;4-[2,5-dibromo-4-(4-sulfonatobutoxy)phenoxy]butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCOc1cc(Br)c(OCCCCS(=O)(=O)[O-])cc1Br.[Na+].[Na+] |
| InChI | InChI=1S/C14H20Br2O8S2.2Na/c15-11-10-14(24-6-2-4-8-26(20,21)22)12(16)9-13(11)23-5-1-3-7-25(17,18)19;;/h9-10H,1-8H2,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | VEKQOPLAKYXMHK-UHFFFAOYSA-L |
| XLogP | -3.37 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.21 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|