C24H31Br5O2 — CID 161271933
1,4-dibromo-2,5-dihexoxybenzene;1,3,5-tribromobenzene (PubChem CID 161271933) has the molecular formula C24H31Br5O2 and a molecular weight of 751.03 g/mol. Its IUPAC name is 1,4-dibromo-2,5-dihexoxybenzene;1,3,5-tribromobenzene.
| Compound Name | 1,4-dibromo-2,5-dihexoxybenzene;1,3,5-tribromobenzene |
|---|---|
| PubChem CID | 161271933 |
| Molecular Formula | C24H31Br5O2 |
| Molecular Weight | 751.03 g/mol |
| Exact Mass | 745.82 |
| IUPAC Name | 1,4-dibromo-2,5-dihexoxybenzene;1,3,5-tribromobenzene |
| SMILES | Brc1cc(Br)cc(Br)c1.CCCCCCOc1cc(Br)c(OCCCCCC)cc1Br |
| InChI | InChI=1S/C18H28Br2O2.C6H3Br3/c1-3-5-7-9-11-21-17-13-16(20)18(14-15(17)19)22-12-10-8-6-4-2;7-4-1-5(8)3-6(9)2-4/h13-14H,3-12H2,1-2H3;1-3H |
| InChIKey | VDXZJDRBWCKINP-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.03 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|