C36H45Br3O3 — CID 88922830
2,6,10-tribromo-3,7,11-trihexoxytriphenylene (PubChem CID 88922830) has the molecular formula C36H45Br3O3 and a molecular weight of 765.46 g/mol. Its IUPAC name is 2,6,10-tribromo-3,7,11-trihexoxytriphenylene.
| Compound Name | 2,6,10-tribromo-3,7,11-trihexoxytriphenylene |
|---|---|
| PubChem CID | 88922830 |
| Molecular Formula | C36H45Br3O3 |
| Molecular Weight | 765.46 g/mol |
| Exact Mass | 762.09 |
| IUPAC Name | 2,6,10-tribromo-3,7,11-trihexoxytriphenylene |
| SMILES | CCCCCCOc1cc2c(cc1Br)c1cc(OCCCCCC)c(Br)cc1c1cc(OCCCCCC)c(Br)cc21 |
| InChI | InChI=1S/C36H45Br3O3/c1-4-7-10-13-16-40-34-22-28-25(19-31(34)37)29-23-35(41-17-14-11-8-5-2)33(39)21-27(29)30-24-36(32(38)20-26(28)30)42-18-15-12-9-6-3/h19-24H,4-18H2,1-3H3 |
| InChIKey | XGYJIGRMVGKQAS-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.46 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|