C13H18Br2O — CID 101293515
2,4-dibromo-1-heptoxybenzene (PubChem CID 101293515) has the molecular formula C13H18Br2O and a molecular weight of 350.09 g/mol. Its IUPAC name is 2,4-dibromo-1-heptoxybenzene.
| Compound Name | 2,4-dibromo-1-heptoxybenzene |
|---|---|
| PubChem CID | 101293515 |
| Molecular Formula | C13H18Br2O |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2,4-dibromo-1-heptoxybenzene |
| SMILES | CCCCCCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H18Br2O/c1-2-3-4-5-6-9-16-13-8-7-11(14)10-12(13)15/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | FDQHNFHVVGAPJU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|