C14H20Br2O — CID 101293529
2,4-dibromo-1-octoxybenzene (PubChem CID 101293529) has the molecular formula C14H20Br2O and a molecular weight of 364.12 g/mol. Its IUPAC name is 2,4-dibromo-1-octoxybenzene.
| Compound Name | 2,4-dibromo-1-octoxybenzene |
|---|---|
| PubChem CID | 101293529 |
| Molecular Formula | C14H20Br2O |
| Molecular Weight | 364.12 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2,4-dibromo-1-octoxybenzene |
| SMILES | CCCCCCCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H20Br2O/c1-2-3-4-5-6-7-10-17-14-9-8-12(15)11-13(14)16/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | LITNTLFDBSCZBX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|