C11H13Br2ClO — CID 64718438
2,4-dibromo-1-(5-chloropentoxy)benzene (PubChem CID 64718438) has the molecular formula C11H13Br2ClO and a molecular weight of 356.49 g/mol. Its IUPAC name is 2,4-dibromo-1-(5-chloropentoxy)benzene.
| Compound Name | 2,4-dibromo-1-(5-chloropentoxy)benzene |
|---|---|
| PubChem CID | 64718438 |
| Molecular Formula | C11H13Br2ClO |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 353.90 |
| IUPAC Name | 2,4-dibromo-1-(5-chloropentoxy)benzene |
| SMILES | ClCCCCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2ClO/c12-9-4-5-11(10(13)8-9)15-7-3-1-2-6-14/h4-5,8H,1-3,6-7H2 |
| InChIKey | AENFECYVBRBTHO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|