C11H14Br2N2O — CID 64718456
5-(2,4-dibromophenoxy)pentanimidamide (PubChem CID 64718456) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 5-(2,4-dibromophenoxy)pentanimidamide.
| Compound Name | 5-(2,4-dibromophenoxy)pentanimidamide |
|---|---|
| PubChem CID | 64718456 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 5-(2,4-dibromophenoxy)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCOc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H14Br2N2O/c12-8-4-5-10(9(13)7-8)16-6-2-1-3-11(14)15/h4-5,7H,1-3,6H2,(H3,14,15) |
| InChIKey | JMSGGBBALCDNHH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|