C10H10BrCl3O — CID 107657601
1-bromo-2,5-dichloro-4-(4-chlorobutoxy)benzene (PubChem CID 107657601) has the molecular formula C10H10BrCl3O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-bromo-2,5-dichloro-4-(4-chlorobutoxy)benzene.
| Compound Name | 1-bromo-2,5-dichloro-4-(4-chlorobutoxy)benzene |
|---|---|
| PubChem CID | 107657601 |
| Molecular Formula | C10H10BrCl3O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | 1-bromo-2,5-dichloro-4-(4-chlorobutoxy)benzene |
| SMILES | ClCCCCOc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C10H10BrCl3O/c11-7-5-9(14)10(6-8(7)13)15-4-2-1-3-12/h5-6H,1-4H2 |
| InChIKey | ASZFPYBVKZZFBD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|