4-(4-bromo-2,5-dichlorophenoxy)butanoic acid

C10H9BrCl2O3 — CID 22687414

IUPAC4-(4-bromo-2,5-dichlorophenoxy)butanoic acid
SMILESO=C(O)CCCOc1cc(Cl)c(Br)cc1Cl
InChIInChI=1S/C10H9BrCl2O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15)
InChIKeyGHCPOFYWRGTIAV-UHFFFAOYSA-N
MW327.99 g/mol
LogP4.00
Rot. Bonds5

About 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid

4-(4-bromo-2,5-dichlorophenoxy)butanoic acid (PubChem CID 22687414) has the molecular formula C10H9BrCl2O3 and a molecular weight of 327.99 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid.

Molecular Properties

Compound Name4-(4-bromo-2,5-dichlorophenoxy)butanoic acid
PubChem CID22687414
Molecular FormulaC10H9BrCl2O3
Molecular Weight327.99 g/mol
Exact Mass325.91
IUPAC Name4-(4-bromo-2,5-dichlorophenoxy)butanoic acid
SMILESO=C(O)CCCOc1cc(Cl)c(Br)cc1Cl
InChIInChI=1S/C10H9BrCl2O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15)
InChIKeyGHCPOFYWRGTIAV-UHFFFAOYSA-N
XLogP4.00
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.99
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid?
The IUPAC name of 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid (CID 22687414) is 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid.
What is the SMILES notation for 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid?
The canonical SMILES for 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid is O=C(O)CCCOc1cc(Cl)c(Br)cc1Cl.
What is the InChIKey of 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid?
The InChIKey is GHCPOFYWRGTIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrCl2O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15).
What are the key properties of 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid?
4-(4-bromo-2,5-dichlorophenoxy)butanoic acid has a molecular weight of 327.99 g/mol, XLogP of 4.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-2,5-dichlorophenoxy)butanoic acid is sourced from PubChem (CID 22687414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).