C13H15BrCl2N2O2S — CID 107658202
N-(3-amino-3-sulfanylidenepropyl)-3-(4-bromo-2,5-dichlorophenoxy)-N-methylpropanamide (PubChem CID 107658202) has the molecular formula C13H15BrCl2N2O2S and a molecular weight of 414.15 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-(4-bromo-2,5-dichlorophenoxy)-N-methylpropanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-(4-bromo-2,5-dichlorophenoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 107658202 |
| Molecular Formula | C13H15BrCl2N2O2S |
| Molecular Weight | 414.15 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-(4-bromo-2,5-dichlorophenoxy)-N-methylpropanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCOc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H15BrCl2N2O2S/c1-18(4-2-12(17)21)13(19)3-5-20-11-7-9(15)8(14)6-10(11)16/h6-7H,2-5H2,1H3,(H2,17,21) |
| InChIKey | CZULTDQJMIWUTD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|