C12H13Cl3N2O2S — CID 43291162
N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 43291162) has the molecular formula C12H13Cl3N2O2S and a molecular weight of 355.67 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 43291162 |
| Molecular Formula | C12H13Cl3N2O2S |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-methyl-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CN(CCC(N)=S)C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl3N2O2S/c1-17(3-2-11(16)20)12(18)6-19-10-5-8(14)7(13)4-9(10)15/h4-5H,2-3,6H2,1H3,(H2,16,20) |
| InChIKey | HAOWRMNGQKFERR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|