C10H9Cl3N2O4 — CID 112550685
2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]oxyacetamide (PubChem CID 112550685) has the molecular formula C10H9Cl3N2O4 and a molecular weight of 327.55 g/mol. Its IUPAC name is 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]oxyacetamide.
| Compound Name | 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]oxyacetamide |
|---|---|
| PubChem CID | 112550685 |
| Molecular Formula | C10H9Cl3N2O4 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]oxyacetamide |
| SMILES | NC(=O)CONC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl3N2O4/c11-5-1-7(13)8(2-6(5)12)18-4-10(17)15-19-3-9(14)16/h1-2H,3-4H2,(H2,14,16)(H,15,17) |
| InChIKey | SUOCTCUSWJNKRA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|