C10H7Cl3F3NO3 — CID 81340218
2-(2,4,5-trichlorophenoxy)-N-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 81340218) has the molecular formula C10H7Cl3F3NO3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)-N-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | 2-(2,4,5-trichlorophenoxy)-N-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 81340218 |
| Molecular Formula | C10H7Cl3F3NO3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)-N-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NOCC(F)(F)F |
| InChI | InChI=1S/C10H7Cl3F3NO3/c11-5-1-7(13)8(2-6(5)12)19-3-9(18)17-20-4-10(14,15)16/h1-2H,3-4H2,(H,17,18) |
| InChIKey | VMNCXWIXGWVHKR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|