C11H6Cl3F3N4O2 — CID 46548915
2-(2,4,5-trichlorophenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]acetamide (PubChem CID 46548915) has the molecular formula C11H6Cl3F3N4O2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]acetamide.
| Compound Name | 2-(2,4,5-trichlorophenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 46548915 |
| Molecular Formula | C11H6Cl3F3N4O2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H6Cl3F3N4O2/c12-4-1-6(14)7(2-5(4)13)23-3-8(22)18-10-19-9(20-21-10)11(15,16)17/h1-2H,3H2,(H2,18,19,20,21,22) |
| InChIKey | OWKLOHQBLWYOSG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|